C33H43F2NO — CID 22384798
2-[4-[2,6-difluoro-4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 22384798) has the molecular formula C33H43F2NO and a molecular weight of 507.71 g/mol. Its IUPAC name is 2-[4-[2,6-difluoro-4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[4-[2,6-difluoro-4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 22384798 |
| Molecular Formula | C33H43F2NO |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | 2-[4-[2,6-difluoro-4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)phenyl]phenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCCCCCC1CCC2CC(c3cc(F)c(-c4ccc(C5=NC(C)(C)CO5)cc4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C33H43F2NO/c1-4-5-6-7-8-22-9-10-26-18-27(16-15-25(26)17-22)28-19-29(34)31(30(35)20-28)23-11-13-24(14-12-23)32-36-33(2,3)21-37-32/h11-14,19-20,22,25-27H,4-10,15-18,21H2,1-3H3 |
| InChIKey | GRPHVZXWPQBYMN-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|