C32H41F2NO — CID 20809299
2-[4-[4-[(2R,4aR,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]-2,6-difluorophenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 20809299) has the molecular formula C32H41F2NO and a molecular weight of 493.68 g/mol. Its IUPAC name is 2-[4-[4-[(2R,4aR,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]-2,6-difluorophenyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[4-[4-[(2R,4aR,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]-2,6-difluorophenyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 20809299 |
| Molecular Formula | C32H41F2NO |
| Molecular Weight | 493.68 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | 2-[4-[4-[(2R,4aR,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]-2,6-difluorophenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CCCCCC1CC[C@@H]2C[C@H](c3ccc(-c4cc(F)c(C5=NC(C)(C)CO5)c(F)c4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C32H41F2NO/c1-4-5-6-7-21-8-9-26-17-25(15-14-24(26)16-21)22-10-12-23(13-11-22)27-18-28(33)30(29(34)19-27)31-35-32(2,3)20-36-31/h10-13,18-19,21,24-26H,4-9,14-17,20H2,1-3H3/t21?,24-,25-,26-/m1/s1 |
| InChIKey | HOFNWOJNRRCUPQ-ZSZFIPSZSA-N |
| XLogP | 9.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.68 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|