C28H34F4 — CID 20809409
(2R,4aR,8aR)-2-[4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809409) has the molecular formula C28H34F4 and a molecular weight of 446.57 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809409 |
| Molecular Formula | C28H34F4 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(C(F)(F)F)c(F)c4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C28H34F4/c1-2-3-4-5-19-6-7-24-17-23(13-12-22(24)16-19)20-8-10-21(11-9-20)25-14-15-26(27(29)18-25)28(30,31)32/h8-11,14-15,18-19,22-24H,2-7,12-13,16-17H2,1H3/t19?,22-,23-,24-/m1/s1 |
| InChIKey | AGBRENDBTJYTTN-RDJJLVMJSA-N |
| XLogP | 9.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|