C25H28F4 — CID 22384116
2-ethyl-6-[4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22384116) has the molecular formula C25H28F4 and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-ethyl-6-[4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-ethyl-6-[4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22384116 |
| Molecular Formula | C25H28F4 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-ethyl-6-[4-[3-fluoro-4-(trifluoromethyl)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCC1CCC2CC(c3ccc(-c4ccc(C(F)(F)F)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C25H28F4/c1-2-16-3-4-21-14-20(10-9-19(21)13-16)17-5-7-18(8-6-17)22-11-12-23(24(26)15-22)25(27,28)29/h5-8,11-12,15-16,19-21H,2-4,9-10,13-14H2,1H3 |
| InChIKey | OKRAIFSFTQTUOK-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |