C25H27F5O — CID 22384069
2-ethyl-6-[3-fluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22384069) has the molecular formula C25H27F5O and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-ethyl-6-[3-fluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-ethyl-6-[3-fluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22384069 |
| Molecular Formula | C25H27F5O |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2-ethyl-6-[3-fluoro-4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCC1CCC2CC(c3ccc(-c4ccc(OC(F)(F)F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C25H27F5O/c1-2-15-3-4-17-12-18(6-5-16(17)11-15)19-7-9-21(22(26)13-19)20-8-10-24(23(27)14-20)31-25(28,29)30/h7-10,13-18H,2-6,11-12H2,1H3 |
| InChIKey | VTOSKOYWRNJEKK-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |