C27H30F4O — CID 139866202
2-but-3-enyl-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139866202) has the molecular formula C27H30F4O and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-but-3-enyl-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139866202 |
| Molecular Formula | C27H30F4O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-but-3-enyl-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CCC2CC(c3ccc(-c4ccc(OC(F)(F)F)c(F)c4)cc3)CCC2C1 |
| InChI | InChI=1S/C27H30F4O/c1-2-3-4-18-5-6-23-16-22(12-11-21(23)15-18)19-7-9-20(10-8-19)24-13-14-26(25(28)17-24)32-27(29,30)31/h2,7-10,13-14,17-18,21-23H,1,3-6,11-12,15-16H2 |
| InChIKey | DPPJLUNAWRFWFM-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|