C27H27F7O — CID 139869372
2-but-3-enyl-6-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139869372) has the molecular formula C27H27F7O and a molecular weight of 500.50 g/mol. Its IUPAC name is 2-but-3-enyl-6-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139869372 |
| Molecular Formula | C27H27F7O |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 2-but-3-enyl-6-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CCC2CC(c3cc(F)c(-c4cc(F)c(OC(F)(F)F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C27H27F7O/c1-2-3-4-15-5-6-17-10-18(8-7-16(17)9-15)19-11-21(28)25(22(29)12-19)20-13-23(30)26(24(31)14-20)35-27(32,33)34/h2,11-18H,1,3-10H2 |
| InChIKey | CWPSNEJGBBPKLM-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|