C27H30F4 — CID 139867900
2-but-3-enyl-6-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139867900) has the molecular formula C27H30F4 and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-but-3-enyl-6-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139867900 |
| Molecular Formula | C27H30F4 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 2-but-3-enyl-6-[4-(3,5-difluoro-4-methylphenyl)-3,5-difluorophenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CCC2CC(c3cc(F)c(-c4cc(F)c(C)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C27H30F4/c1-3-4-5-17-6-7-19-11-20(9-8-18(19)10-17)21-12-25(30)27(26(31)13-21)22-14-23(28)16(2)24(29)15-22/h3,12-15,17-20H,1,4-11H2,2H3 |
| InChIKey | UMYQGTGLFLWJQH-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|