C31H37F3 — CID 139870390
2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139870390) has the molecular formula C31H37F3 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139870390 |
| Molecular Formula | C31H37F3 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 2-but-3-enyl-6-[3,5-difluoro-4-[3-fluoro-4-[(E)-pent-3-enyl]phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CCC2CC(c3cc(F)c(-c4ccc(CC/C=C/C)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C31H37F3/c1-3-5-7-9-22-12-15-26(18-28(22)32)31-29(33)19-27(20-30(31)34)25-14-13-23-16-21(8-6-4-2)10-11-24(23)17-25/h3-5,12,15,18-21,23-25H,2,6-11,13-14,16-17H2,1H3/b5-3+ |
| InChIKey | KXZKTFUXLLOZKF-HWKANZROSA-N |
| XLogP | 9.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|