C29H34F2O — CID 139869738
2-but-3-enyl-6-[3,5-difluoro-4-(4-prop-2-enoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139869738) has the molecular formula C29H34F2O and a molecular weight of 436.59 g/mol. Its IUPAC name is 2-but-3-enyl-6-[3,5-difluoro-4-(4-prop-2-enoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[3,5-difluoro-4-(4-prop-2-enoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139869738 |
| Molecular Formula | C29H34F2O |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 2-but-3-enyl-6-[3,5-difluoro-4-(4-prop-2-enoxyphenyl)phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CCCC1CCC2CC(c3cc(F)c(-c4ccc(OCC=C)cc4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C29H34F2O/c1-3-5-6-20-7-8-23-17-24(10-9-22(23)16-20)25-18-27(30)29(28(31)19-25)21-11-13-26(14-12-21)32-15-4-2/h3-4,11-14,18-20,22-24H,1-2,5-10,15-17H2 |
| InChIKey | MIPVQESIWDOZEQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|