C30H35FO3 — CID 139868909
(4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-fluorobenzoate (PubChem CID 139868909) has the molecular formula C30H35FO3 and a molecular weight of 462.61 g/mol. Its IUPAC name is (4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-fluorobenzoate.
| Compound Name | (4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-fluorobenzoate |
|---|---|
| PubChem CID | 139868909 |
| Molecular Formula | C30H35FO3 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (4-prop-2-enoxyphenyl) 4-(6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-fluorobenzoate |
| SMILES | C=CCCC1CCC2CC(c3ccc(C(=O)Oc4ccc(OCC=C)cc4)cc3F)CCC2C1 |
| InChI | InChI=1S/C30H35FO3/c1-3-5-6-21-7-8-23-19-24(10-9-22(23)18-21)28-16-11-25(20-29(28)31)30(32)34-27-14-12-26(13-15-27)33-17-4-2/h3-4,11-16,20-24H,1-2,5-10,17-19H2 |
| InChIKey | LLSNNBHKTNVOGI-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|