C32H43FO2 — CID 20808099
(4-ethylphenyl) 4-[(4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluorobenzoate (PubChem CID 20808099) has the molecular formula C32H43FO2 and a molecular weight of 478.69 g/mol. Its IUPAC name is (4-ethylphenyl) 4-[(4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluorobenzoate.
| Compound Name | (4-ethylphenyl) 4-[(4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 20808099 |
| Molecular Formula | C32H43FO2 |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | (4-ethylphenyl) 4-[(4aS,6S,8aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-fluorobenzoate |
| SMILES | CCCCCCC[C@H]1CC[C@@H]2CC(c3ccc(C(=O)Oc4ccc(CC)cc4)cc3F)CC[C@H]2C1 |
| InChI | InChI=1S/C32H43FO2/c1-3-5-6-7-8-9-24-10-13-26-21-27(15-14-25(26)20-24)30-19-16-28(22-31(30)33)32(34)35-29-17-11-23(4-2)12-18-29/h11-12,16-19,22,24-27H,3-10,13-15,20-21H2,1-2H3/t24-,25-,26+,27?/m0/s1 |
| InChIKey | VSFWSBLAWXRQTO-LNQJTCQQSA-N |
| XLogP | 9.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|