C29H32F3NO2 — CID 20808019
(4-cyano-3-fluorophenyl) 4-[(4aS,6S,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,5-difluorobenzoate (PubChem CID 20808019) has the molecular formula C29H32F3NO2 and a molecular weight of 483.57 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-[(4aS,6S,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,5-difluorobenzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-[(4aS,6S,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 20808019 |
| Molecular Formula | C29H32F3NO2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-[(4aS,6S,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,5-difluorobenzoate |
| SMILES | CCCCC[C@H]1CC[C@@H]2CC(c3c(F)cc(C(=O)Oc4ccc(C#N)c(F)c4)cc3F)CC[C@H]2C1 |
| InChI | InChI=1S/C29H32F3NO2/c1-2-3-4-5-18-6-7-20-13-21(9-8-19(20)12-18)28-26(31)14-23(15-27(28)32)29(34)35-24-11-10-22(17-33)25(30)16-24/h10-11,14-16,18-21H,2-9,12-13H2,1H3/t18-,19-,20+,21?/m0/s1 |
| InChIKey | VDDMSAXBDMEEIM-CBQMWWCCSA-N |
| XLogP | 8.08 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|