C23H32F2O2 — CID 141020406
3,5-difluoro-4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoic acid (PubChem CID 141020406) has the molecular formula C23H32F2O2 and a molecular weight of 378.50 g/mol. Its IUPAC name is 3,5-difluoro-4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoic acid.
| Compound Name | 3,5-difluoro-4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoic acid |
|---|---|
| PubChem CID | 141020406 |
| Molecular Formula | C23H32F2O2 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 3,5-difluoro-4-(6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)benzoic acid |
| SMILES | CCCCCCC1CCC2CC(c3c(F)cc(C(=O)O)cc3F)CCC2C1 |
| InChI | InChI=1S/C23H32F2O2/c1-2-3-4-5-6-15-7-8-17-12-18(10-9-16(17)11-15)22-20(24)13-19(23(26)27)14-21(22)25/h13-18H,2-12H2,1H3,(H,26,27) |
| InChIKey | BYBNZPZRCWJKRZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|