C26H31F3O2 — CID 141020470
1,3,8-trifluoro-6-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)naphthalene-2-carboxylic acid (PubChem CID 141020470) has the molecular formula C26H31F3O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 1,3,8-trifluoro-6-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)naphthalene-2-carboxylic acid.
| Compound Name | 1,3,8-trifluoro-6-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 141020470 |
| Molecular Formula | C26H31F3O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1,3,8-trifluoro-6-(6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)naphthalene-2-carboxylic acid |
| SMILES | CCCCCC1CCC2CC(c3cc(F)c4c(F)c(C(=O)O)c(F)cc4c3)CCC2C1 |
| InChI | InChI=1S/C26H31F3O2/c1-2-3-4-5-15-6-7-17-11-18(9-8-16(17)10-15)19-12-20-14-22(28)24(26(30)31)25(29)23(20)21(27)13-19/h12-18H,2-11H2,1H3,(H,30,31) |
| InChIKey | RIMKGJZKZTUCSU-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|