C29H37F3O2 — CID 22383978
methyl 1,3,8-trifluoro-6-(6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)naphthalene-2-carboxylate (PubChem CID 22383978) has the molecular formula C29H37F3O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is methyl 1,3,8-trifluoro-6-(6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)naphthalene-2-carboxylate.
| Compound Name | methyl 1,3,8-trifluoro-6-(6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 22383978 |
| Molecular Formula | C29H37F3O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | methyl 1,3,8-trifluoro-6-(6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)naphthalene-2-carboxylate |
| SMILES | CCCCCCCC1CCC2CC(c3cc(F)c4c(F)c(C(=O)OC)c(F)cc4c3)CCC2C1 |
| InChI | InChI=1S/C29H37F3O2/c1-3-4-5-6-7-8-18-9-10-20-14-21(12-11-19(20)13-18)22-15-23-17-25(31)27(29(33)34-2)28(32)26(23)24(30)16-22/h15-21H,3-14H2,1-2H3 |
| InChIKey | XJQJBUURVWJCRV-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|