C28H36F2O2 — CID 20808758
methyl 6-[(4aS,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,4-difluoronaphthalene-2-carboxylate (PubChem CID 20808758) has the molecular formula C28H36F2O2 and a molecular weight of 442.59 g/mol. Its IUPAC name is methyl 6-[(4aS,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,4-difluoronaphthalene-2-carboxylate.
| Compound Name | methyl 6-[(4aS,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,4-difluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 20808758 |
| Molecular Formula | C28H36F2O2 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | methyl 6-[(4aS,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3,4-difluoronaphthalene-2-carboxylate |
| SMILES | CCCCCCC1CC[C@@H]2CC(c3ccc4cc(C(=O)OC)c(F)c(F)c4c3)CC[C@H]2C1 |
| InChI | InChI=1S/C28H36F2O2/c1-3-4-5-6-7-18-8-9-20-15-21(11-10-19(20)14-18)22-12-13-23-17-25(28(31)32-2)27(30)26(29)24(23)16-22/h12-13,16-21H,3-11,14-15H2,1-2H3/t18?,19-,20+,21?/m0/s1 |
| InChIKey | OEOCLQUOCLWWJT-RKDVLTNBSA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|