C30H40F2O — CID 20807521
7-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2-difluoro-3-prop-2-enoxynaphthalene (PubChem CID 20807521) has the molecular formula C30H40F2O and a molecular weight of 454.65 g/mol. Its IUPAC name is 7-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2-difluoro-3-prop-2-enoxynaphthalene.
| Compound Name | 7-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2-difluoro-3-prop-2-enoxynaphthalene |
|---|---|
| PubChem CID | 20807521 |
| Molecular Formula | C30H40F2O |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 7-[(2R,4aR)-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2-difluoro-3-prop-2-enoxynaphthalene |
| SMILES | C=CCOc1cc2ccc([C@@H]3CC[C@@H]4CC(CCCCCCC)CCC4C3)cc2c(F)c1F |
| InChI | InChI=1S/C30H40F2O/c1-3-5-6-7-8-9-21-10-11-23-18-24(13-12-22(23)17-21)25-14-15-26-20-28(33-16-4-2)30(32)29(31)27(26)19-25/h4,14-15,19-24H,2-3,5-13,16-18H2,1H3/t21?,22-,23?,24-/m1/s1 |
| InChIKey | GRFDVOYVDXFAAO-UGAUIIJPSA-N |
| XLogP | 9.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|