C28H36F2O — CID 20807539
7-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(E)-but-2-enoxy]-1,2-difluoronaphthalene (PubChem CID 20807539) has the molecular formula C28H36F2O and a molecular weight of 426.59 g/mol. Its IUPAC name is 7-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(E)-but-2-enoxy]-1,2-difluoronaphthalene.
| Compound Name | 7-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(E)-but-2-enoxy]-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 20807539 |
| Molecular Formula | C28H36F2O |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 7-[(2R,4aR)-6-butyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-3-[(E)-but-2-enoxy]-1,2-difluoronaphthalene |
| SMILES | C/C=C/COc1cc2ccc([C@@H]3CC[C@@H]4CC(CCCC)CCC4C3)cc2c(F)c1F |
| InChI | InChI=1S/C28H36F2O/c1-3-5-7-19-8-9-21-16-22(11-10-20(21)15-19)23-12-13-24-18-26(31-14-6-4-2)28(30)27(29)25(24)17-23/h4,6,12-13,17-22H,3,5,7-11,14-16H2,1-2H3/b6-4+/t19?,20-,21?,22-/m1/s1 |
| InChIKey | WNFADJUVPGAFNE-JVULAZMYSA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|