C29H39FO — CID 20807788
6-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-fluoro-2-prop-2-enoxynaphthalene (PubChem CID 20807788) has the molecular formula C29H39FO and a molecular weight of 422.63 g/mol. Its IUPAC name is 6-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-fluoro-2-prop-2-enoxynaphthalene.
| Compound Name | 6-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-fluoro-2-prop-2-enoxynaphthalene |
|---|---|
| PubChem CID | 20807788 |
| Molecular Formula | C29H39FO |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 6-[(2R,4aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1-fluoro-2-prop-2-enoxynaphthalene |
| SMILES | C=CCOc1ccc2cc([C@@H]3CC[C@@H]4CC(CCCCCC)CCC4C3)ccc2c1F |
| InChI | InChI=1S/C29H39FO/c1-3-5-6-7-8-21-9-10-23-19-24(12-11-22(23)18-21)25-13-15-27-26(20-25)14-16-28(29(27)30)31-17-4-2/h4,13-16,20-24H,2-3,5-12,17-19H2,1H3/t21?,22-,23?,24-/m1/s1 |
| InChIKey | BEGXIKOXTZRRGU-UGAUIIJPSA-N |
| XLogP | 8.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|