C26H33F3O — CID 20808319
6-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-(difluoromethoxy)-1-fluoronaphthalene (PubChem CID 20808319) has the molecular formula C26H33F3O and a molecular weight of 418.54 g/mol. Its IUPAC name is 6-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-(difluoromethoxy)-1-fluoronaphthalene.
| Compound Name | 6-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-(difluoromethoxy)-1-fluoronaphthalene |
|---|---|
| PubChem CID | 20808319 |
| Molecular Formula | C26H33F3O |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 6-[(6R,8aR)-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-2-(difluoromethoxy)-1-fluoronaphthalene |
| SMILES | CCCCC[C@@H]1CC[C@@H]2CC(c3ccc4c(F)c(OC(F)F)ccc4c3)CCC2C1 |
| InChI | InChI=1S/C26H33F3O/c1-2-3-4-5-17-6-7-19-15-20(9-8-18(19)14-17)21-10-12-23-22(16-21)11-13-24(25(23)27)30-26(28)29/h10-13,16-20,26H,2-9,14-15H2,1H3/t17-,18?,19-,20?/m1/s1 |
| InChIKey | LRDKRBZKDLALCJ-ADEKHHIBSA-N |
| XLogP | 8.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|