C30H37F5O — CID 22385149
2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22385149) has the molecular formula C30H37F5O and a molecular weight of 508.62 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22385149 |
| Molecular Formula | C30H37F5O |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 2-[4-[4-(difluoromethoxy)-3-fluorophenyl]-3,5-difluorophenyl]-6-heptyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCCC1CCC2CC(c3cc(F)c(-c4ccc(OC(F)F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C30H37F5O/c1-2-3-4-5-6-7-19-8-9-21-15-22(11-10-20(21)14-19)24-17-26(32)29(27(33)18-24)23-12-13-28(25(31)16-23)36-30(34)35/h12-13,16-22,30H,2-11,14-15H2,1H3 |
| InChIKey | YYGQNDYHPXWNFN-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|