C35H41F3O — CID 20808914
(2R,4aR,8aR)-2-[3,5-difluoro-4-(3-fluoro-4-phenylmethoxyphenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20808914) has the molecular formula C35H41F3O and a molecular weight of 534.71 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[3,5-difluoro-4-(3-fluoro-4-phenylmethoxyphenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[3,5-difluoro-4-(3-fluoro-4-phenylmethoxyphenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20808914 |
| Molecular Formula | C35H41F3O |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | (2R,4aR,8aR)-2-[3,5-difluoro-4-(3-fluoro-4-phenylmethoxyphenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCC1CC[C@@H]2C[C@H](c3cc(F)c(-c4ccc(OCc5ccccc5)c(F)c4)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C35H41F3O/c1-2-3-4-6-9-24-12-13-27-19-28(15-14-26(27)18-24)30-21-32(37)35(33(38)22-30)29-16-17-34(31(36)20-29)39-23-25-10-7-5-8-11-25/h5,7-8,10-11,16-17,20-22,24,26-28H,2-4,6,9,12-15,18-19,23H2,1H3/t24?,26-,27-,28-/m1/s1 |
| InChIKey | CRAVERBCKLJXKL-UYIWATPZSA-N |
| XLogP | 10.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|