C35H42F2O — CID 20809128
(2R,4aR,8aR)-2-[3-fluoro-4-(3-fluoro-4-phenylmethoxyphenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809128) has the molecular formula C35H42F2O and a molecular weight of 516.72 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[3-fluoro-4-(3-fluoro-4-phenylmethoxyphenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[3-fluoro-4-(3-fluoro-4-phenylmethoxyphenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809128 |
| Molecular Formula | C35H42F2O |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | (2R,4aR,8aR)-2-[3-fluoro-4-(3-fluoro-4-phenylmethoxyphenyl)phenyl]-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(OCc5ccccc5)c(F)c4)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C35H42F2O/c1-2-3-4-6-9-25-12-13-28-21-29(15-14-27(28)20-25)30-16-18-32(33(36)22-30)31-17-19-35(34(37)23-31)38-24-26-10-7-5-8-11-26/h5,7-8,10-11,16-19,22-23,25,27-29H,2-4,6,9,12-15,20-21,24H2,1H3/t25?,27-,28-,29-/m1/s1 |
| InChIKey | UVHFGBKFZUYKRN-VZXWBTEVSA-N |
| XLogP | 10.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|