C34H40F2O — CID 20809306
(2R,4aR,8aR)-2-[4-(3,5-difluoro-4-phenylmethoxyphenyl)phenyl]-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809306) has the molecular formula C34H40F2O and a molecular weight of 502.69 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-(3,5-difluoro-4-phenylmethoxyphenyl)phenyl]-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-(3,5-difluoro-4-phenylmethoxyphenyl)phenyl]-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809306 |
| Molecular Formula | C34H40F2O |
| Molecular Weight | 502.69 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-(3,5-difluoro-4-phenylmethoxyphenyl)phenyl]-6-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCCCC1CC[C@@H]2C[C@H](c3ccc(-c4cc(F)c(OCc5ccccc5)c(F)c4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C34H40F2O/c1-2-3-5-8-24-11-12-30-20-29(18-17-28(30)19-24)26-13-15-27(16-14-26)31-21-32(35)34(33(36)22-31)37-23-25-9-6-4-7-10-25/h4,6-7,9-10,13-16,21-22,24,28-30H,2-3,5,8,11-12,17-20,23H2,1H3/t24?,28-,29-,30-/m1/s1 |
| InChIKey | ZYTRRYZYIFCYNR-JQFBCDDISA-N |
| XLogP | 10.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.69 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|