C31H33F3O — CID 20809063
(2R,4aR,8aR)-2-[4-(3,5-difluoro-4-phenylmethoxyphenyl)-3-fluorophenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809063) has the molecular formula C31H33F3O and a molecular weight of 478.60 g/mol. Its IUPAC name is (2R,4aR,8aR)-2-[4-(3,5-difluoro-4-phenylmethoxyphenyl)-3-fluorophenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (2R,4aR,8aR)-2-[4-(3,5-difluoro-4-phenylmethoxyphenyl)-3-fluorophenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809063 |
| Molecular Formula | C31H33F3O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (2R,4aR,8aR)-2-[4-(3,5-difluoro-4-phenylmethoxyphenyl)-3-fluorophenyl]-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCC1CC[C@@H]2C[C@H](c3ccc(-c4cc(F)c(OCc5ccccc5)c(F)c4)c(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C31H33F3O/c1-2-20-8-9-23-15-24(11-10-22(23)14-20)25-12-13-27(28(32)16-25)26-17-29(33)31(30(34)18-26)35-19-21-6-4-3-5-7-21/h3-7,12-13,16-18,20,22-24H,2,8-11,14-15,19H2,1H3/t20?,22-,23-,24-/m1/s1 |
| InChIKey | SILYEBGCZHBXOE-AYFDPRGUSA-N |
| XLogP | 9.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |