C28H33F3O — CID 139868607
2-[4-(3,5-difluoro-4-methoxyphenyl)-3-fluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139868607) has the molecular formula C28H33F3O and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-[4-(3,5-difluoro-4-methoxyphenyl)-3-fluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-(3,5-difluoro-4-methoxyphenyl)-3-fluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139868607 |
| Molecular Formula | C28H33F3O |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 2-[4-(3,5-difluoro-4-methoxyphenyl)-3-fluorophenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCC1CCC2CC(c3ccc(-c4cc(F)c(OC)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C28H33F3O/c1-3-4-5-6-18-7-8-20-14-21(10-9-19(20)13-18)22-11-12-24(25(29)15-22)23-16-26(30)28(32-2)27(31)17-23/h3-4,11-12,15-21H,5-10,13-14H2,1-2H3/b4-3+ |
| InChIKey | GLGDFSPPKUTBEQ-ONEGZZNKSA-N |
| XLogP | 8.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|