C28H31F2N — CID 139870646
2-fluoro-4-[2-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]benzonitrile (PubChem CID 139870646) has the molecular formula C28H31F2N and a molecular weight of 419.56 g/mol. Its IUPAC name is 2-fluoro-4-[2-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]benzonitrile.
| Compound Name | 2-fluoro-4-[2-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139870646 |
| Molecular Formula | C28H31F2N |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 2-fluoro-4-[2-fluoro-4-[6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]phenyl]benzonitrile |
| SMILES | C/C=C/CCC1CCC2CC(c3ccc(-c4ccc(C#N)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C28H31F2N/c1-2-3-4-5-19-6-7-21-15-22(9-8-20(21)14-19)23-12-13-26(28(30)16-23)24-10-11-25(18-31)27(29)17-24/h2-3,10-13,16-17,19-22H,4-9,14-15H2,1H3/b3-2+ |
| InChIKey | MUSAXJIFJLSMIT-NSCUHMNNSA-N |
| XLogP | 8.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|