C30H32F4O — CID 139867685
2-[3-fluoro-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139867685) has the molecular formula C30H32F4O and a molecular weight of 484.58 g/mol. Its IUPAC name is 2-[3-fluoro-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[3-fluoro-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139867685 |
| Molecular Formula | C30H32F4O |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 2-[3-fluoro-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]phenyl]-6-[(E)-pent-3-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/CCC1CCC2CC(c3ccc(C#Cc4ccc(OC(F)(F)F)cc4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C30H32F4O/c1-2-3-4-5-22-7-11-25-19-26(15-14-24(25)18-22)27-13-12-23(29(31)20-27)10-6-21-8-16-28(17-9-21)35-30(32,33)34/h2-3,8-9,12-13,16-17,20,22,24-26H,4-5,7,11,14-15,18-19H2,1H3/b3-2+ |
| InChIKey | HFAFTMQRZNNCGK-NSCUHMNNSA-N |
| XLogP | 8.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|