C30H33FO — CID 139867247
2-[4-[2-[4-[(E)-but-2-enoxy]phenyl]ethynyl]-3-fluorophenyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139867247) has the molecular formula C30H33FO and a molecular weight of 428.59 g/mol. Its IUPAC name is 2-[4-[2-[4-[(E)-but-2-enoxy]phenyl]ethynyl]-3-fluorophenyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[2-[4-[(E)-but-2-enoxy]phenyl]ethynyl]-3-fluorophenyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139867247 |
| Molecular Formula | C30H33FO |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2-[4-[2-[4-[(E)-but-2-enoxy]phenyl]ethynyl]-3-fluorophenyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CC1CCC2CC(c3ccc(C#Cc4ccc(OC/C=C/C)cc4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C30H33FO/c1-3-5-18-32-29-16-8-23(9-17-29)7-10-24-12-13-28(21-30(24)31)27-15-14-25-19-22(4-2)6-11-26(25)20-27/h3-5,8-9,12-13,16-17,21-22,25-27H,2,6,11,14-15,18-20H2,1H3/b5-3+ |
| InChIKey | RUHGIGVISQZKIW-HWKANZROSA-N |
| XLogP | 7.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|