C28H38F2O — CID 139870133
2-[4-[4-[(E)-but-2-enoxy]-3,5-difluorophenyl]cyclohexyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139870133) has the molecular formula C28H38F2O and a molecular weight of 428.61 g/mol. Its IUPAC name is 2-[4-[4-[(E)-but-2-enoxy]-3,5-difluorophenyl]cyclohexyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[4-[(E)-but-2-enoxy]-3,5-difluorophenyl]cyclohexyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139870133 |
| Molecular Formula | C28H38F2O |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-[4-[4-[(E)-but-2-enoxy]-3,5-difluorophenyl]cyclohexyl]-6-ethenyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C=CC1CCC2CC(C3CCC(c4cc(F)c(OC/C=C/C)c(F)c4)CC3)CCC2C1 |
| InChI | InChI=1S/C28H38F2O/c1-3-5-14-31-28-26(29)17-25(18-27(28)30)21-10-8-20(9-11-21)23-13-12-22-15-19(4-2)6-7-24(22)16-23/h3-5,17-24H,2,6-16H2,1H3/b5-3+ |
| InChIKey | RDXNYERCYKAWCS-HWKANZROSA-N |
| XLogP | 8.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|