C23H30F2O — CID 90721636
(4aR,6R,8aR)-2-(4-but-2-enoxy-3,5-difluorophenyl)-6-prop-1-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 90721636) has the molecular formula C23H30F2O and a molecular weight of 360.49 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-(4-but-2-enoxy-3,5-difluorophenyl)-6-prop-1-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-(4-but-2-enoxy-3,5-difluorophenyl)-6-prop-1-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 90721636 |
| Molecular Formula | C23H30F2O |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (4aR,6R,8aR)-2-(4-but-2-enoxy-3,5-difluorophenyl)-6-prop-1-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC=CCOc1c(F)cc(C2CC[C@@H]3C[C@H](C=CC)CC[C@@H]3C2)cc1F |
| InChI | InChI=1S/C23H30F2O/c1-3-5-11-26-23-21(24)14-20(15-22(23)25)19-10-9-17-12-16(6-4-2)7-8-18(17)13-19/h3-6,14-19H,7-13H2,1-2H3/t16-,17-,18-,19?/m1/s1 |
| InChIKey | WHLYXHKBNXLQLY-SLZIBOOSSA-N |
| XLogP | 6.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|