C20H26F2O — CID 22384362
2-(3,5-difluoro-4-methoxyphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 22384362) has the molecular formula C20H26F2O and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-methoxyphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-(3,5-difluoro-4-methoxyphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 22384362 |
| Molecular Formula | C20H26F2O |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-(3,5-difluoro-4-methoxyphenyl)-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC2CC(c3cc(F)c(OC)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C20H26F2O/c1-3-4-13-5-6-15-10-16(8-7-14(15)9-13)17-11-18(21)20(23-2)19(22)12-17/h3-4,11-16H,5-10H2,1-2H3/b4-3+ |
| InChIKey | BZEMRHZISKIWPJ-ONEGZZNKSA-N |
| XLogP | 5.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|