C26H26F6O — CID 139869120
2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-3-fluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 139869120) has the molecular formula C26H26F6O and a molecular weight of 468.48 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-3-fluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-3-fluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 139869120 |
| Molecular Formula | C26H26F6O |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]-3-fluorophenyl]-6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C/C=C/C1CCC2CC(c3ccc(-c4cc(F)c(OC(F)(F)F)c(F)c4)c(F)c3)CCC2C1 |
| InChI | InChI=1S/C26H26F6O/c1-2-3-15-4-5-17-11-18(7-6-16(17)10-15)19-8-9-21(22(27)12-19)20-13-23(28)25(24(29)14-20)33-26(30,31)32/h2-3,8-9,12-18H,4-7,10-11H2,1H3/b3-2+ |
| InChIKey | SWGVXXPICCRICJ-NSCUHMNNSA-N |
| XLogP | 8.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|