C21H20F4 — CID 54486923
1,2,3-trifluoro-5-[2-fluoro-4-(4-prop-1-enylcyclohexyl)phenyl]benzene (PubChem CID 54486923) has the molecular formula C21H20F4 and a molecular weight of 348.38 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[2-fluoro-4-(4-prop-1-enylcyclohexyl)phenyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[2-fluoro-4-(4-prop-1-enylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 54486923 |
| Molecular Formula | C21H20F4 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1,2,3-trifluoro-5-[2-fluoro-4-(4-prop-1-enylcyclohexyl)phenyl]benzene |
| SMILES | CC=CC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C21H20F4/c1-2-3-13-4-6-14(7-5-13)15-8-9-17(18(22)10-15)16-11-19(23)21(25)20(24)12-16/h2-3,8-14H,4-7H2,1H3 |
| InChIKey | XSYWOMIEELHXIY-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|