C18H16F4O — CID 141391242
4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexan-1-ol (PubChem CID 141391242) has the molecular formula C18H16F4O and a molecular weight of 324.32 g/mol. Its IUPAC name is 4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexan-1-ol.
| Compound Name | 4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 141391242 |
| Molecular Formula | C18H16F4O |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexan-1-ol |
| SMILES | OC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C18H16F4O/c19-15-7-11(10-1-4-13(23)5-2-10)3-6-14(15)12-8-16(20)18(22)17(21)9-12/h3,6-10,13,23H,1-2,4-5H2 |
| InChIKey | VFJDXVCSTHOOCD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|