C24H28F3OP — CID 134374865
4-[4-[4-(3,4-difluoro-5-phosphanylphenyl)-3-fluorophenyl]cyclohexyl]cyclohexan-1-ol (PubChem CID 134374865) has the molecular formula C24H28F3OP and a molecular weight of 420.46 g/mol. Its IUPAC name is 4-[4-[4-(3,4-difluoro-5-phosphanylphenyl)-3-fluorophenyl]cyclohexyl]cyclohexan-1-ol.
| Compound Name | 4-[4-[4-(3,4-difluoro-5-phosphanylphenyl)-3-fluorophenyl]cyclohexyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134374865 |
| Molecular Formula | C24H28F3OP |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[4-[4-(3,4-difluoro-5-phosphanylphenyl)-3-fluorophenyl]cyclohexyl]cyclohexan-1-ol |
| SMILES | OC1CCC(C2CCC(c3ccc(-c4cc(F)c(F)c(P)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H28F3OP/c25-21-11-17(7-10-20(21)18-12-22(26)24(27)23(29)13-18)16-3-1-14(2-4-16)15-5-8-19(28)9-6-15/h7,10-16,19,28H,1-6,8-9,29H2 |
| InChIKey | KDULVGAIIOCDIV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|