C18H14F4O — CID 18787931
4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexan-1-one (PubChem CID 18787931) has the molecular formula C18H14F4O and a molecular weight of 322.30 g/mol. Its IUPAC name is 4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexan-1-one.
| Compound Name | 4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 18787931 |
| Molecular Formula | C18H14F4O |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 4-[3-fluoro-4-(3,4,5-trifluorophenyl)phenyl]cyclohexan-1-one |
| SMILES | O=C1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C18H14F4O/c19-15-7-11(10-1-4-13(23)5-2-10)3-6-14(15)12-8-16(20)18(22)17(21)9-12/h3,6-10H,1-2,4-5H2 |
| InChIKey | PWZUHNXKBLRYCU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|