C19H20ClF3 — CID 157087004
2-chloro-1,3-difluoro-5-[2-fluoro-4-(4-methylcyclohexyl)phenyl]benzene;molecular hydrogen (PubChem CID 157087004) has the molecular formula C19H20ClF3 and a molecular weight of 340.82 g/mol. Its IUPAC name is 2-chloro-1,3-difluoro-5-[2-fluoro-4-(4-methylcyclohexyl)phenyl]benzene;molecular hydrogen.
| Compound Name | 2-chloro-1,3-difluoro-5-[2-fluoro-4-(4-methylcyclohexyl)phenyl]benzene;molecular hydrogen |
|---|---|
| PubChem CID | 157087004 |
| Molecular Formula | C19H20ClF3 |
| Molecular Weight | 340.82 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-chloro-1,3-difluoro-5-[2-fluoro-4-(4-methylcyclohexyl)phenyl]benzene;molecular hydrogen |
| SMILES | CC1CCC(c2ccc(-c3cc(F)c(Cl)c(F)c3)c(F)c2)CC1.[H][H] |
| InChI | InChI=1S/C19H18ClF3.H2/c1-11-2-4-12(5-3-11)13-6-7-15(16(21)8-13)14-9-17(22)19(20)18(23)10-14;/h6-12H,2-5H2,1H3;1H |
| InChIKey | AEEZAJZQHWAIFZ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.82 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|