C17H18F2S — CID 153380811
2-fluoro-5-[2-fluoro-4-(4-methylcyclohexyl)phenyl]thiophene (PubChem CID 153380811) has the molecular formula C17H18F2S and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-fluoro-5-[2-fluoro-4-(4-methylcyclohexyl)phenyl]thiophene.
| Compound Name | 2-fluoro-5-[2-fluoro-4-(4-methylcyclohexyl)phenyl]thiophene |
|---|---|
| PubChem CID | 153380811 |
| Molecular Formula | C17H18F2S |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-fluoro-5-[2-fluoro-4-(4-methylcyclohexyl)phenyl]thiophene |
| SMILES | CC1CCC(c2ccc(-c3ccc(F)s3)c(F)c2)CC1 |
| InChI | InChI=1S/C17H18F2S/c1-11-2-4-12(5-3-11)13-6-7-14(15(18)10-13)16-8-9-17(19)20-16/h6-12H,2-5H2,1H3 |
| InChIKey | LBAHVELRFQFGIN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |