C20H29F — CID 23574055
1-fluoro-2-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene (PubChem CID 23574055) has the molecular formula C20H29F and a molecular weight of 288.45 g/mol. Its IUPAC name is 1-fluoro-2-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 1-fluoro-2-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 23574055 |
| Molecular Formula | C20H29F |
| Molecular Weight | 288.45 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 1-fluoro-2-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
| SMILES | Cc1cc(C2CCC(C3CCC(C)CC3)CC2)ccc1F |
| InChI | InChI=1S/C20H29F/c1-14-3-5-16(6-4-14)17-7-9-18(10-8-17)19-11-12-20(21)15(2)13-19/h11-14,16-18H,3-10H2,1-2H3 |
| InChIKey | KHUILSOVSXYLRS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |