C32H51F — CID 91598886
cyclohexylcyclohexane;2-fluoro-1-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene (PubChem CID 91598886) has the molecular formula C32H51F and a molecular weight of 454.76 g/mol. Its IUPAC name is cyclohexylcyclohexane;2-fluoro-1-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene.
| Compound Name | cyclohexylcyclohexane;2-fluoro-1-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 91598886 |
| Molecular Formula | C32H51F |
| Molecular Weight | 454.76 g/mol |
| Exact Mass | 454.40 |
| IUPAC Name | cyclohexylcyclohexane;2-fluoro-1-methyl-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene |
| SMILES | C1CCC(C2CCCCC2)CC1.Cc1ccc(C2CCC(C3CCC(C)CC3)CC2)cc1F |
| InChI | InChI=1S/C20H29F.C12H22/c1-14-3-6-16(7-4-14)17-9-11-18(12-10-17)19-8-5-15(2)20(21)13-19;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h5,8,13-14,16-18H,3-4,6-7,9-12H2,1-2H3;11-12H,1-10H2 |
| InChIKey | BMBLDLBVLBLSSM-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.76 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |