C21H28ClF — CID 18656305
4-[4-[4-[(E)-2-chloroethenyl]cyclohexyl]cyclohexyl]-2-fluoro-1-methylbenzene (PubChem CID 18656305) has the molecular formula C21H28ClF and a molecular weight of 334.91 g/mol. Its IUPAC name is 4-[4-[4-[(E)-2-chloroethenyl]cyclohexyl]cyclohexyl]-2-fluoro-1-methylbenzene.
| Compound Name | 4-[4-[4-[(E)-2-chloroethenyl]cyclohexyl]cyclohexyl]-2-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 18656305 |
| Molecular Formula | C21H28ClF |
| Molecular Weight | 334.91 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-[4-[4-[(E)-2-chloroethenyl]cyclohexyl]cyclohexyl]-2-fluoro-1-methylbenzene |
| SMILES | Cc1ccc(C2CCC(C3CCC(/C=C/Cl)CC3)CC2)cc1F |
| InChI | InChI=1S/C21H28ClF/c1-15-2-5-20(14-21(15)23)19-10-8-18(9-11-19)17-6-3-16(4-7-17)12-13-22/h2,5,12-14,16-19H,3-4,6-11H2,1H3/b13-12+ |
| InChIKey | QKQMHHYIJGYGBO-OUKQBFOZSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.91 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |