C14H21FSi — CID 137329605
[4-(3-fluoro-4-methylphenyl)cyclohexyl]methylsilane (PubChem CID 137329605) has the molecular formula C14H21FSi and a molecular weight of 236.41 g/mol. Its IUPAC name is [4-(3-fluoro-4-methylphenyl)cyclohexyl]methylsilane.
| Compound Name | [4-(3-fluoro-4-methylphenyl)cyclohexyl]methylsilane |
|---|---|
| PubChem CID | 137329605 |
| Molecular Formula | C14H21FSi |
| Molecular Weight | 236.41 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [4-(3-fluoro-4-methylphenyl)cyclohexyl]methylsilane |
| SMILES | Cc1ccc(C2CCC(C[SiH3])CC2)cc1F |
| InChI | InChI=1S/C14H21FSi/c1-10-2-5-13(8-14(10)15)12-6-3-11(9-16)4-7-12/h2,5,8,11-12H,3-4,6-7,9H2,1,16H3 |
| InChIKey | JVFVLNMKYOOODB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|