C26H35FSi — CID 137329327
[4-[4-[3-fluoro-4-(4-methylphenyl)phenyl]cyclohexyl]cyclohexyl]methylsilane (PubChem CID 137329327) has the molecular formula C26H35FSi and a molecular weight of 394.65 g/mol. Its IUPAC name is [4-[4-[3-fluoro-4-(4-methylphenyl)phenyl]cyclohexyl]cyclohexyl]methylsilane.
| Compound Name | [4-[4-[3-fluoro-4-(4-methylphenyl)phenyl]cyclohexyl]cyclohexyl]methylsilane |
|---|---|
| PubChem CID | 137329327 |
| Molecular Formula | C26H35FSi |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | [4-[4-[3-fluoro-4-(4-methylphenyl)phenyl]cyclohexyl]cyclohexyl]methylsilane |
| SMILES | Cc1ccc(-c2ccc(C3CCC(C4CCC(C[SiH3])CC4)CC3)cc2F)cc1 |
| InChI | InChI=1S/C26H35FSi/c1-18-2-6-23(7-3-18)25-15-14-24(16-26(25)27)22-12-10-21(11-13-22)20-8-4-19(17-28)5-9-20/h2-3,6-7,14-16,19-22H,4-5,8-13,17H2,1,28H3 |
| InChIKey | VWYHHVGVPINZGJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|