C20H22F2 — CID 67806520
1-[4-(4-ethylcyclohexyl)phenyl]-2,4-difluorobenzene (PubChem CID 67806520) has the molecular formula C20H22F2 and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-[4-(4-ethylcyclohexyl)phenyl]-2,4-difluorobenzene.
| Compound Name | 1-[4-(4-ethylcyclohexyl)phenyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 67806520 |
| Molecular Formula | C20H22F2 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-[4-(4-ethylcyclohexyl)phenyl]-2,4-difluorobenzene |
| SMILES | CCC1CCC(c2ccc(-c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C20H22F2/c1-2-14-3-5-15(6-4-14)16-7-9-17(10-8-16)19-12-11-18(21)13-20(19)22/h7-15H,2-6H2,1H3 |
| InChIKey | AQOPLWBFDYAABB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |