C11H13F3 — CID 157032368
ethylcyclopropane;1,2,4-trifluorobenzene (PubChem CID 157032368) has the molecular formula C11H13F3 and a molecular weight of 202.22 g/mol. Its IUPAC name is ethylcyclopropane;1,2,4-trifluorobenzene.
| Compound Name | ethylcyclopropane;1,2,4-trifluorobenzene |
|---|---|
| PubChem CID | 157032368 |
| Molecular Formula | C11H13F3 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | ethylcyclopropane;1,2,4-trifluorobenzene |
| SMILES | CCC1CC1.Fc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C6H3F3.C5H10/c7-4-1-2-5(8)6(9)3-4;1-2-5-3-4-5/h1-3H;5H,2-4H2,1H3 |
| InChIKey | WXKXUYGWTMHDHS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|