C22H24F2N2 — CID 54354891
N-[(3,4-difluorophenyl)methylideneamino]-1-[4-(4-ethylcyclohexyl)phenyl]methanimine (PubChem CID 54354891) has the molecular formula C22H24F2N2 and a molecular weight of 354.44 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methylideneamino]-1-[4-(4-ethylcyclohexyl)phenyl]methanimine.
| Compound Name | N-[(3,4-difluorophenyl)methylideneamino]-1-[4-(4-ethylcyclohexyl)phenyl]methanimine |
|---|---|
| PubChem CID | 54354891 |
| Molecular Formula | C22H24F2N2 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[(3,4-difluorophenyl)methylideneamino]-1-[4-(4-ethylcyclohexyl)phenyl]methanimine |
| SMILES | CCC1CCC(c2ccc(C=NN=Cc3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H24F2N2/c1-2-16-3-8-19(9-4-16)20-10-5-17(6-11-20)14-25-26-15-18-7-12-21(23)22(24)13-18/h5-7,10-16,19H,2-4,8-9H2,1H3 |
| InChIKey | UIKVNOUUEHLZOZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|