C22H34F2Si — CID 137327778
2-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]ethyl-ethylsilane (PubChem CID 137327778) has the molecular formula C22H34F2Si and a molecular weight of 364.60 g/mol. Its IUPAC name is 2-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]ethyl-ethylsilane.
| Compound Name | 2-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]ethyl-ethylsilane |
|---|---|
| PubChem CID | 137327778 |
| Molecular Formula | C22H34F2Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-[4-[4-(3,4-difluorophenyl)cyclohexyl]cyclohexyl]ethyl-ethylsilane |
| SMILES | CC[SiH2]CCC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H34F2Si/c1-2-25-14-13-16-3-5-17(6-4-16)18-7-9-19(10-8-18)20-11-12-21(23)22(24)15-20/h11-12,15-19H,2-10,13-14,25H2,1H3 |
| InChIKey | AWMAUQBDERFOQF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|