C22H32F2 — CID 154010858
4-[4-(4-tert-butylcyclohexyl)cyclohexyl]-1,2-difluorobenzene (PubChem CID 154010858) has the molecular formula C22H32F2 and a molecular weight of 334.49 g/mol. Its IUPAC name is 4-[4-(4-tert-butylcyclohexyl)cyclohexyl]-1,2-difluorobenzene.
| Compound Name | 4-[4-(4-tert-butylcyclohexyl)cyclohexyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 154010858 |
| Molecular Formula | C22H32F2 |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 4-[4-(4-tert-butylcyclohexyl)cyclohexyl]-1,2-difluorobenzene |
| SMILES | CC(C)(C)C1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H32F2/c1-22(2,3)19-11-8-16(9-12-19)15-4-6-17(7-5-15)18-10-13-20(23)21(24)14-18/h10,13-17,19H,4-9,11-12H2,1-3H3 |
| InChIKey | MHCZRTTWRHMOGB-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |